ChemNet > CAS > 627-09-8 Propargylacetate(Aceticacidpropargylester)
627-09-8 Propargylacetate(Aceticacidpropargylester)
| اسم المنتج |
Propargylacetate(Aceticacidpropargylester) |
| الاسم المستعار |
Propargyl acetate (Acetic acid propargyl ester); Propargyl acetate; Acetic acid propargyl ester~2-Propyn-1-yl acetate; prop-2-ynyl acetate |
| الصيغة الجزيئية |
C5H6O2 |
| الوزن الجزيئي الغرامي |
98.0999 |
| InChI |
InChI=1/C5H6O2/c1-3-4-7-5(2)6/h1H,4H2,2H3 |
| إستراتيجية المساعدة القطرية |
627-09-8 |
| بنية جزيئية |
|
| كثافة |
0.997g/cm3 |
| نقطة الغليان |
122.4°C at 760 mmHg |
| معامل الإنكسار |
1.418 |
| نقطة الوميض |
28.3°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R10:Flammable.;
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
