ChemNet > CAS > 6373-50-8 4-Cyclohexylaniline
6373-50-8 4-Cyclohexylaniline
اسم المنتج |
4-Cyclohexylaniline |
الاسم المستعار |
1-(2,4-dichlorophenyl)-3-[5-(4-methylphenyl)-1,3,4-thiadiazol-2-yl]urea |
الصيغة الجزيئية |
C16H12Cl2N4OS |
الوزن الجزيئي الغرامي |
379.2637 |
InChI |
InChI=1/C16H12Cl2N4OS/c1-9-2-4-10(5-3-9)14-21-22-16(24-14)20-15(23)19-13-7-6-11(17)8-12(13)18/h2-8H,1H3,(H2,19,20,22,23) |
إستراتيجية المساعدة القطرية |
6373-50-8 |
المفوضية الأوروبية رقم |
228-918-9 |
بنية جزيئية |
|
كثافة |
1.509g/cm3 |
معامل الإنكسار |
1.716 |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|