ChemNet > CAS > 6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
6396-76-5 1-(2,6-Dimethylphenyl)-thiourea
اسم المنتج |
1-(2,6-Dimethylphenyl)-thiourea |
الاسم المستعار |
2,6-Dimethylphenylthiourea |
الصيغة الجزيئية |
C9H12N2S |
الوزن الجزيئي الغرامي |
180.27 |
InChI |
InChI=1/C9H12N2S/c1-6-4-3-5-7(2)8(6)11-9(10)12/h3-5H,1-2H3,(H3,10,11,12) |
إستراتيجية المساعدة القطرية |
6396-76-5 |
المفوضية الأوروبية رقم |
229-005-8 |
بنية جزيئية |
|
كثافة |
1.2g/cm3 |
نقطة الغليان |
284.4°C at 760 mmHg |
معامل الإنكسار |
1.674 |
نقطة الوميض |
125.8°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R25:Toxic if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|