ChemNet > CAS > 643-28-7 2-Isopropylaniline
643-28-7 2-Isopropylaniline
| اسم المنتج |
2-Isopropylaniline |
| الاسم المستعار |
2-Aminocumene; 2-(1-methylethyl)-benzenamine; 2-(propan-2-yl)aniline |
| الصيغة الجزيئية |
C9H13N |
| الوزن الجزيئي الغرامي |
135.2062 |
| InChI |
InChI=1/C9H13N/c1-7(2)8-5-3-4-6-9(8)10/h3-7H,10H2,1-2H3 |
| إستراتيجية المساعدة القطرية |
643-28-7 |
| المفوضية الأوروبية رقم |
211-397-7 |
| بنية جزيئية |
|
| كثافة |
0.953g/cm3 |
| نقطة الغليان |
225.6°C at 760 mmHg |
| معامل الإنكسار |
1.542 |
| نقطة الوميض |
95.6°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| شروط الأمن |
S28:After contact with skin, wash immediately with plenty of ...;
S36/37:Wear suitable protective clothing and gloves.;
|
|
