ChemNet > CAS > 660425-16-1 2-Bromo-3,5-difluoropyridine
660425-16-1 2-Bromo-3,5-difluoropyridine
اسم المنتج |
2-Bromo-3,5-difluoropyridine |
الصيغة الجزيئية |
C5H2BrF2N |
الوزن الجزيئي الغرامي |
193.97 |
InChI |
InChI=1/C5H2BrF2N/c6-5-4(8)1-3(7)2-9-5/h1-2H |
إستراتيجية المساعدة القطرية |
660425-16-1 |
بنية جزيئية |
|
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|