ChemNet > CAS > 68087-13-8 4-hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine
68087-13-8 4-hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine
| اسم المنتج |
4-hydroxy-6-methoxymethyl-2-(methylthio)pyrimidine |
| الاسم المستعار |
6-(methoxymethyl)-2-(methylsulfanyl)pyrimidin-4(1H)-one |
| الصيغة الجزيئية |
C7H10N2O2S |
| الوزن الجزيئي الغرامي |
186.2315 |
| InChI |
InChI=1/C7H10N2O2S/c1-11-4-5-3-6(10)9-7(8-5)12-2/h3H,4H2,1-2H3,(H,8,9,10) |
| إستراتيجية المساعدة القطرية |
68087-13-8 |
| بنية جزيئية |
|
| كثافة |
1.3g/cm3 |
| نقطة الغليان |
286.6°C at 760 mmHg |
| معامل الإنكسار |
1.588 |
| نقطة الوميض |
127.2°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
