ChemNet > CAS > 68412-48-6 2-Propanone, reaction products with diphenylamine
68412-48-6 2-Propanone, reaction products with diphenylamine
اسم المنتج |
2-Propanone, reaction products with diphenylamine |
الاسم المستعار |
Acetone diphenylamine condensation products; Acetone, diphenylamine condensation product; Diphenylamine, acetone reaction product; N-Phenylbenzeneamine, 2-propanone reaction product; propan-2-one-N-cyclohexylcyclohexanamine (1:1); propan-2-one-N-phenylaniline (1:1); Acetone Diphenylamine; Antioxidant BLE; Rubber Antioxidant BLE-W |
الصيغة الجزيئية |
C15H17NO |
الوزن الجزيئي الغرامي |
227.3016 |
InChI |
InChI=1/C12H11N.C3H6O/c1-3-7-11(8-4-1)13-12-9-5-2-6-10-12;1-3(2)4/h1-10,13H;1-2H3 |
إستراتيجية المساعدة القطرية |
68412-48-6 |
المفوضية الأوروبية رقم |
270-192-0 |
بنية جزيئية |
|
نقطة الغليان |
302°C at 760 mmHg |
نقطة الوميض |
152.8°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
|
|