ChemNet > CAS > 6843-66-9 Diphenyldimethoxysilane
6843-66-9 Diphenyldimethoxysilane
اسم المنتج |
Diphenyldimethoxysilane |
الاسم المستعار |
Dimethoxydiphenylsilane; Diphenyl dimethoxylsilicane |
الصيغة الجزيئية |
C14H18O2Si |
الوزن الجزيئي الغرامي |
246.377 |
InChI |
InChI=1/C12H10.C2H8O2Si/c1-3-7-11(8-4-1)12-9-5-2-6-10-12;1-3-5-4-2/h1-10H;5H2,1-2H3 |
إستراتيجية المساعدة القطرية |
6843-66-9 |
المفوضية الأوروبية رقم |
229-929-1 |
بنية جزيئية |
|
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R38:;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|