ChemNet > CAS > 69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
69687-80-5 methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate
اسم المنتج |
methyl 2,5-dimethyl-1H-pyrrole-3-carboxylate |
الاسم المستعار |
Methyl 2,5-dimethylpyrrole-3-carboxylate |
الصيغة الجزيئية |
C8H11NO2 |
الوزن الجزيئي الغرامي |
153.1784 |
InChI |
InChI=1/C8H11NO2/c1-5-4-7(6(2)9-5)8(10)11-3/h4,9H,1-3H3 |
إستراتيجية المساعدة القطرية |
69687-80-5 |
بنية جزيئية |
|
كثافة |
1.108g/cm3 |
درجة الإنصهار |
115℃ |
نقطة الغليان |
294.3°C at 760 mmHg |
معامل الإنكسار |
1.521 |
نقطة الوميض |
131.8°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|