ChemNet > CAS > 697-90-5 2,4-Dichloro-6-iodoaniline
697-90-5 2,4-Dichloro-6-iodoaniline
اسم المنتج |
2,4-Dichloro-6-iodoaniline |
الصيغة الجزيئية |
C6H4Cl2IN |
الوزن الجزيئي الغرامي |
287.9131 |
InChI |
InChI=1/C6H4Cl2IN/c7-3-1-4(8)6(10)5(9)2-3/h1-2H,10H2 |
إستراتيجية المساعدة القطرية |
697-90-5 |
بنية جزيئية |
|
كثافة |
2.091g/cm3 |
نقطة الغليان |
303.8°C at 760 mmHg |
معامل الإنكسار |
1.699 |
نقطة الوميض |
137.5°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|