ChemNet > CAS > 7116-95-2 4-isopropylbiphenyl
7116-95-2 4-isopropylbiphenyl
| اسم المنتج |
4-isopropylbiphenyl |
| الاسم المستعار |
Biphenyl, 4-isopropyl-; 1,1'-Biphenyl, 4-(1-methylethyl)-; 4-07-00-01638 (Beilstein Handbook Reference); BRN 1858288; p-Isopropyldiphenyl |
| الصيغة الجزيئية |
C15H16 |
| الوزن الجزيئي الغرامي |
196.29 |
| InChI |
InChI=1/C15H16/c1-12(2)13-8-10-15(11-9-13)14-6-4-3-5-7-14/h3-12H,1-2H3 |
| إستراتيجية المساعدة القطرية |
7116-95-2 |
| المفوضية الأوروبية رقم |
230-420-1 |
| بنية جزيئية |
|
| كثافة |
110 |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S24/25:Avoid contact with skin and eyes.;
|
|
