ChemNet > CAS > 729-43-1 Acetophenone Azine
729-43-1 Acetophenone Azine
| اسم المنتج |
Acetophenone Azine |
| الاسم المستعار |
Ethanone, 1-phenyl-, 2-(1-phenylethylidene)hydrazone; Acetophenone azine; Ethanone, 1-phenyl-, (1-phenylethylidene)hydrazone; NSC 25772; 1-Phenylethan-1-one (1-phenylethylidene)hydrazone; Acetophenone, azine (8CI); bis(1-phenylethylidene)hydrazine; (1Z,2Z)-bis(1-phenylethylidene)hydrazine; (1E,2E)-bis(1-phenylethylidene)hydrazine |
| الصيغة الجزيئية |
C16H16N2 |
| الوزن الجزيئي الغرامي |
236.3116 |
| InChI |
InChI=1/C16H16N2/c1-13(15-9-5-3-6-10-15)17-18-14(2)16-11-7-4-8-12-16/h3-12H,1-2H3/b17-13+,18-14+ |
| إستراتيجية المساعدة القطرية |
729-43-1 |
| المفوضية الأوروبية رقم |
211-979-0 |
| بنية جزيئية |
|
| كثافة |
0.98g/cm3 |
| نقطة الغليان |
333.2°C at 760 mmHg |
| معامل الإنكسار |
1.551 |
| نقطة الوميض |
147.4°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|
