ChemNet > CAS > 75-27-4 Bromodichloromethane
75-27-4 Bromodichloromethane
| اسم المنتج |
Bromodichloromethane |
| الاسم المستعار |
FC-20B1 |
| الصيغة الجزيئية |
CHBrCl2 |
| الوزن الجزيئي الغرامي |
163.8286 |
| InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
| إستراتيجية المساعدة القطرية |
75-27-4 |
| المفوضية الأوروبية رقم |
200-856-7 |
| بنية جزيئية |
|
| كثافة |
2.013g/cm3 |
| درجة الإنصهار |
-55℃ |
| نقطة الغليان |
89.7°C at 760 mmHg |
| معامل الإنكسار |
1.503 |
| نقطة الوميض |
1.3°C |
| علامات على البضائع الخطرة |
 Xn:Harmful;
|
| خطر المصطلحات |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
| شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
