ChemNet > CAS > 75-27-4 Bromodichloromethane
75-27-4 Bromodichloromethane
اسم المنتج |
Bromodichloromethane |
الاسم المستعار |
FC-20B1 |
الصيغة الجزيئية |
CHBrCl2 |
الوزن الجزيئي الغرامي |
163.8286 |
InChI |
InChI=1/CHBrCl2/c2-1(3)4/h1H |
إستراتيجية المساعدة القطرية |
75-27-4 |
المفوضية الأوروبية رقم |
200-856-7 |
بنية جزيئية |
|
كثافة |
2.013g/cm3 |
درجة الإنصهار |
-55℃ |
نقطة الغليان |
89.7°C at 760 mmHg |
معامل الإنكسار |
1.503 |
نقطة الوميض |
1.3°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
شروط الأمن |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|