ChemNet > CAS > 763-32-6 3-Methyl-3-buten-1-ol
763-32-6 3-Methyl-3-buten-1-ol
| اسم المنتج |
3-Methyl-3-buten-1-ol |
| الاسم المستعار |
Isobutenylcarbinol; 2-Methyl-1-buten-4-ol; 3-Isopentenyl alcohol; Isoprenol; Isopropenylethyl alcohol; Methallylcarbinol; NSC 122673; 3-Buten-1-ol, 3-methyl-; 3-Methylbut-3-en-1-ol |
| الصيغة الجزيئية |
C5H10O |
| الوزن الجزيئي الغرامي |
86.1323 |
| InChI |
InChI=1/C5H10O/c1-5(2)3-4-6/h6H,1,3-4H2,2H3 |
| إستراتيجية المساعدة القطرية |
763-32-6 |
| المفوضية الأوروبية رقم |
212-110-8 |
| بنية جزيئية |
|
| كثافة |
0.832g/cm3 |
| نقطة الغليان |
114.2°C at 760 mmHg |
| معامل الإنكسار |
1.422 |
| نقطة الوميض |
40.1°C |
| علامات على البضائع الخطرة |
 Xi:Irritant;
|
| خطر المصطلحات |
R10:Flammable.;
R36:Irritating to eyes.;
|
| شروط الأمن |
S16:Keep away from sources of ignition - No smoking.;
S24:Avoid contact with skin.;
|
|
