ChemNet > CAS > 78686-87-0 2,5-dichloropyridine-3-carbonyl chloride
78686-87-0 2,5-dichloropyridine-3-carbonyl chloride
اسم المنتج |
2,5-dichloropyridine-3-carbonyl chloride |
الصيغة الجزيئية |
C6H2Cl3NO |
الوزن الجزيئي الغرامي |
210.4452 |
InChI |
InChI=1/C6H2Cl3NO/c7-3-1-4(6(9)11)5(8)10-2-3/h1-2H |
إستراتيجية المساعدة القطرية |
78686-87-0 |
بنية جزيئية |
|
كثافة |
1.582g/cm3 |
نقطة الغليان |
269°C at 760 mmHg |
معامل الإنكسار |
1.582 |
نقطة الوميض |
116.5°C |
علامات على البضائع الخطرة |
C:Corrosive;
|
خطر المصطلحات |
R34:Causes burns.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|