ChemNet > CAS > 80333-65-9 3,3',4,4'-tetrachlorobiphenyl-ul-14C
80333-65-9 3,3',4,4'-tetrachlorobiphenyl-ul-14C
| اسم المنتج |
3,3',4,4'-tetrachlorobiphenyl-ul-14C |
| الاسم المستعار |
1,1'-Biphenyl, 3,3',4,4'-tetrachloro-, labeled with carbon-14; 3,3',4,4'-Tetrachloro(14C-U)biphenyl; 3,3',4,4'-Tetrachloro-1,1'-biphenyl labeled with carbon-14; 3,3',4,4'-tetrachlorobiphenyl |
| الصيغة الجزيئية |
C12H6Cl4 |
| الوزن الجزيئي الغرامي |
291.988 |
| InChI |
InChI=1/C12H6Cl4/c13-9-3-1-7(5-11(9)15)8-2-4-10(14)12(16)6-8/h1-6H |
| إستراتيجية المساعدة القطرية |
80333-65-9 |
| بنية جزيئية |
|
| كثافة |
1.441g/cm3 |
| نقطة الغليان |
380.7°C at 760 mmHg |
| معامل الإنكسار |
1.612 |
| نقطة الوميض |
188.4°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
|
| شروط الأمن |
|
|
