ChemNet > CAS > 83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde
83-18-1 2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde
اسم المنتج |
2,5-Dimethyl-1-phenylpyrrole-3-carboxaldehyde |
الاسم المستعار |
1H-Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl-; NSC 68230; 2,5-Dimethyl-1-phenyl-1H-pyrrole-3-carbaldehyde; Pyrrole-3-carboxaldehyde, 2,5-dimethyl-1-phenyl- (8CI); 1-cyclohexyl-2,5-dimethyl-1H-pyrrole-3-carbaldehyde; 2,5-dimethyl-1-phenylpyrrole-3-carbaldehyde |
الصيغة الجزيئية |
C13H19NO |
الوزن الجزيئي الغرامي |
205.2961 |
InChI |
InChI=1/C13H19NO/c1-10-8-12(9-15)11(2)14(10)13-6-4-3-5-7-13/h8-9,13H,3-7H2,1-2H3 |
إستراتيجية المساعدة القطرية |
83-18-1 |
المفوضية الأوروبية رقم |
201-458-6 |
بنية جزيئية |
|
كثافة |
1.07g/cm3 |
نقطة الغليان |
345.8°C at 760 mmHg |
معامل الإنكسار |
1.559 |
نقطة الوميض |
163°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
|
شروط الأمن |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|