ChemNet > CAS > 84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
84562-48-1 4-Dimethylamino-2-methoxybenzaldehyde
| اسم المنتج |
4-Dimethylamino-2-methoxybenzaldehyde |
| الصيغة الجزيئية |
C10H13NO2 |
| الوزن الجزيئي الغرامي |
179.2157 |
| InChI |
InChI=1/C10H13NO2/c1-11(2)9-5-4-8(7-12)10(6-9)13-3/h4-7H,1-3H3 |
| إستراتيجية المساعدة القطرية |
84562-48-1 |
| بنية جزيئية |
|
| كثافة |
1.098g/cm3 |
| درجة الإنصهار |
59-60℃ |
| نقطة الغليان |
305.9°C at 760 mmHg |
| معامل الإنكسار |
1.576 |
| نقطة الوميض |
138.8°C |
| علامات على البضائع الخطرة |
|
| خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
