ChemNet > CAS > 86508-29-4 1-(4-chlorophenyl)-2-(4-methylphenyl)ethane-1,2-dione
86508-29-4 1-(4-chlorophenyl)-2-(4-methylphenyl)ethane-1,2-dione
اسم المنتج |
1-(4-chlorophenyl)-2-(4-methylphenyl)ethane-1,2-dione |
الصيغة الجزيئية |
C15H11ClO2 |
الوزن الجزيئي الغرامي |
258.6996 |
InChI |
InChI=1/C15H11ClO2/c1-10-2-4-11(5-3-10)14(17)15(18)12-6-8-13(16)9-7-12/h2-9H,1H3 |
إستراتيجية المساعدة القطرية |
86508-29-4 |
بنية جزيئية |
|
كثافة |
1.24g/cm3 |
درجة الإنصهار |
108℃ |
نقطة الغليان |
413.2°C at 760 mmHg |
معامل الإنكسار |
1.595 |
نقطة الوميض |
174.5°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|