ChemNet > CAS > 90567-39-8 3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione
90567-39-8 3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione
اسم المنتج |
3-(hydroxymethyl)-5-(methylthio)-1,3,4-thiadiazole-2(3H)-thione |
الاسم المستعار |
3-(hydroxymethyl)-5-(methylsulfanyl)-1,3,4-thiadiazole-2(3H)-thione |
الصيغة الجزيئية |
C4H6N2OS3 |
الوزن الجزيئي الغرامي |
194.2982 |
InChI |
InChI=1/C4H6N2OS3/c1-9-3-5-6(2-7)4(8)10-3/h7H,2H2,1H3 |
إستراتيجية المساعدة القطرية |
90567-39-8 |
بنية جزيئية |
|
كثافة |
1.64g/cm3 |
درجة الإنصهار |
72℃ |
نقطة الغليان |
306.9°C at 760 mmHg |
معامل الإنكسار |
1.771 |
نقطة الوميض |
139.4°C |
علامات على البضائع الخطرة |
Xi:Irritant;
|
خطر المصطلحات |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|