ChemNet > CAS > 927-67-3 n-Propylthiourea
927-67-3 n-Propylthiourea
اسم المنتج |
n-Propylthiourea |
الاسم المستعار |
Propyl-2-thiourea; Propylthiourea; Thiourea, propyl-; 1-propylthiourea |
الصيغة الجزيئية |
C4H10N2S |
الوزن الجزيئي الغرامي |
118.2006 |
InChI |
InChI=1/C4H10N2S/c1-2-3-6-4(5)7/h2-3H2,1H3,(H3,5,6,7) |
إستراتيجية المساعدة القطرية |
927-67-3 |
المفوضية الأوروبية رقم |
213-158-2 |
بنية جزيئية |
|
كثافة |
1.054g/cm3 |
نقطة الغليان |
182.1°C at 760 mmHg |
معامل الإنكسار |
1.537 |
نقطة الوميض |
63.9°C |
علامات على البضائع الخطرة |
|
خطر المصطلحات |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
شروط الأمن |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|