ChemNet > CAS > 95-26-1 2,5-Dimethylbenzothiazole
95-26-1 2,5-Dimethylbenzothiazole
اسم المنتج |
2,5-Dimethylbenzothiazole |
الاسم المستعار |
Benzothiazole, 2,5-dimethyl-; 2,5-Dimethylbenzthiazol; 2,5-Dimethylbenzthiazol [Czech]; 4-27-00-01101 (Beilstein Handbook Reference); BRN 0116455; 2,5-dimethyl-1,3-benzothiazole |
الصيغة الجزيئية |
C9H9NS |
الوزن الجزيئي الغرامي |
163.2395 |
InChI |
InChI=1/C9H9NS/c1-6-3-4-9-8(5-6)10-7(2)11-9/h3-5H,1-2H3 |
إستراتيجية المساعدة القطرية |
95-26-1 |
المفوضية الأوروبية رقم |
202-404-4 |
بنية جزيئية |
|
كثافة |
1.176g/cm3 |
درجة الإنصهار |
36-40℃ |
نقطة الغليان |
259.4°C at 760 mmHg |
معامل الإنكسار |
1.643 |
نقطة الوميض |
112.7°C |
علامات على البضائع الخطرة |
Xn:Harmful;
|
خطر المصطلحات |
R22:Harmful if swallowed.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
شروط الأمن |
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|