ChemNet > CAS > 95-63-6 1,2,4-Trimethylbenzene
95-63-6 1,2,4-Trimethylbenzene
| اسم المنتج |
1,2,4-Trimethylbenzene |
| الاسم المستعار |
Pseudocumene; 1,2,4-Trimethylbenzere; 1,3,4-Trimethylbenzene |
| الصيغة الجزيئية |
C9H12 |
| الوزن الجزيئي الغرامي |
120.19 |
| InChI |
InChI=1/C9H12/c1-7-4-5-8(2)9(3)6-7/h4-6H,1-3H3 |
| إستراتيجية المساعدة القطرية |
95-63-6 |
| المفوضية الأوروبية رقم |
202-436-9 |
| بنية جزيئية |
|
| كثافة |
0.88 |
| درجة الإنصهار |
-44℃ |
| نقطة الغليان |
168℃ |
| معامل الإنكسار |
1.503-1.505 |
| نقطة الوميض |
48℃ |
| علامات على البضائع الخطرة |
 Xn:Harmful;
 N:Dangerous for the environment;
|
| خطر المصطلحات |
R10:Flammable.;
R20:Harmful by inhalation.;
R36/37/38:Irritating to eyes, respiratory system and skin.;
R51/53:Toxic to aquatic organisms, may cause long-term adverse effects in the aquatic environment.;
|
| شروط الأمن |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S61:Avoid release to the environment. Refer to special instructions / Safety data sheets.;
|
|
