ChemNet > CAS > 122-87-2 N-(4-Hydroxyphenyl)glycine
122-87-2 N-(4-Hydroxyphenyl)glycine
| product Name |
N-(4-Hydroxyphenyl)glycine |
| Synonyms |
Glycin; 4-hydroxyanilinoacetic acid; [(4-hydroxyphenyl)amino]acetate |
| Molecular Formula |
C8H8NO3 |
| Molecular Weight |
166.1546 |
| InChI |
InChI=1/C8H9NO3/c10-7-3-1-6(2-4-7)9-5-8(11)12/h1-4,9-10H,5H2,(H,11,12)/p-1 |
| CAS Registry Number |
122-87-2 |
| EINECS |
204-580-8 |
| Molecular Structure |
|
| Melting point |
248℃ |
| Boiling point |
446.3°C at 760 mmHg |
| Flash point |
223.7°C |
| Vapour Pressur |
9.49E-09mmHg at 25°C |
| Hazard Symbols |
 Xi:Irritant;
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
