ChemNet > CAS > 147-73-9 meso-tartaric acid hydrate
147-73-9 meso-tartaric acid hydrate
| product Name |
meso-tartaric acid hydrate |
| Synonyms |
Mesotartaric acid monohydrate; Mesotartaricacid; Tartaric acid, meso, monohydrate; Mesotartaric acid; (2S)-2,3-dihydroxybutanedioic acid; (2R,3S)-2,3-dihydroxybutanedioic acid |
| Molecular Formula |
C4H6O6 |
| Molecular Weight |
150.0868 |
| InChI |
InChI=1/C4H6O6/c5-1(3(7)8)2(6)4(9)10/h1-2,5-6H,(H,7,8)(H,9,10)/t1-,2+ |
| CAS Registry Number |
147-73-9 |
| EINECS |
205-696-1 |
| Molecular Structure |
|
| Density |
1.886g/cm3 |
| Melting point |
165-166℃ |
| Boiling point |
399.3°C at 760 mmHg |
| Refractive index |
1.585 |
| Flash point |
209.4°C |
| Vapour Pressur |
4.93E-08mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Safety Description |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
