ChemNet > CAS > 28166-41-8 Alpha-Cyano-4-hydroxycinnamic acid
28166-41-8 Alpha-Cyano-4-hydroxycinnamic acid
| product Name |
Alpha-Cyano-4-hydroxycinnamic acid |
| Synonyms |
alpha-Cyano-4-hydroxycinnamate; NSC 173138; 2-Cyano-3-(4-hydroxyphenyl)acrylic acid; 2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid; (2E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoic acid; (2E)-2-cyano-3-(4-hydroxyphenyl)prop-2-enoate |
| Molecular Formula |
C10H6NO3 |
| Molecular Weight |
188.1601 |
| InChI |
InChI=1/C10H7NO3/c11-6-8(10(13)14)5-7-1-3-9(12)4-2-7/h1-5,12H,(H,13,14)/p-1/b8-5+ |
| CAS Registry Number |
28166-41-8 |
| EINECS |
248-879-1 |
| Molecular Structure |
|
| Melting point |
250-253℃ |
| Boiling point |
398.1°C at 760 mmHg |
| Flash point |
194.5°C |
| Vapour Pressur |
4.73E-07mmHg at 25°C |
| Hazard Symbols |
 Xn:Harmful;
|
| Risk Codes |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Safety Description |
S36/37:Wear suitable protective clothing and gloves.;
|
|
