ChemNet > CAS > 638-53-9 n-Tridecanoic acid
638-53-9 n-Tridecanoic acid
| product Name |
n-Tridecanoic acid |
| Synonyms |
Tridecanoicacid; tridecanoic acid; Tridecylic acid |
| Molecular Formula |
C13H26O2 |
| Molecular Weight |
214.3443 |
| InChI |
InChI=1/C13H26O2/c1-2-3-4-5-6-7-8-9-10-11-12-13(14)15/h2-12H2,1H3,(H,14,15) |
| CAS Registry Number |
638-53-9 |
| EINECS |
211-341-1 |
| Molecular Structure |
|
| Density |
0.901g/cm3 |
| Melting point |
41-42℃ |
| Boiling point |
308.2°C at 760 mmHg |
| Refractive index |
1.449 |
| Flash point |
139.6°C |
| Vapour Pressur |
0.000299mmHg at 25°C |
| Hazard Symbols |
|
| Risk Codes |
|
| Safety Description |
S24/25:Avoid contact with skin and eyes.;
|
|
