ChemNet > CAS > 1006-39-9 2-bromo-4-fluoroacetophenone
1006-39-9 2-bromo-4-fluoroacetophenone
| Ürün Adı |
2-bromo-4-fluoroacetophenone |
| Eş anlamlı |
2'-bromo-4'-fluoroacetophenone; 1-(2-bromo-4-fluorophenyl)ethanone |
| Moleküler Formülü |
C8H6BrFO |
| Molekül Ağırlığı |
217.035 |
| InChI |
InChI=1/C8H6BrFO/c1-5(11)7-3-2-6(10)4-8(7)9/h2-4H,1H3 |
| CAS kayıt numarası |
1006-39-9 |
| EINECS |
222-263-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.535g/cm3 |
| Kaynama noktası |
258.4°C at 760 mmHg |
| Kırılma indisi |
1.534 |
| Alevlenme noktası |
110.1°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
