ChemNet > CAS > 103-78-6 cyclohexylacetone
103-78-6 cyclohexylacetone
Ürün Adı |
cyclohexylacetone |
Eş anlamlı |
Cyclohexylacetone, (Acetonylcyclohexane); Acetonylcyclohexane; Cyclohexyacetone; 1-cyclohexylpropan-2-one; 1-cyclohexylacetone |
Moleküler Formülü |
C9H16O |
Molekül Ağırlığı |
140.2227 |
InChI |
InChI=1/C9H16O/c1-8(10)7-9-5-3-2-4-6-9/h9H,2-7H2,1H3 |
CAS kayıt numarası |
103-78-6 |
EINECS |
203-143-9 |
Moleküler Yapısı |
|
Yoğunluk |
0.889g/cm3 |
Kaynama noktası |
188.1°C at 760 mmHg |
Kırılma indisi |
1.441 |
Alevlenme noktası |
65.3°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|