ChemNet > CAS > 10401-11-3 3-Hydroxyphenylacetylene
10401-11-3 3-Hydroxyphenylacetylene
Ürün Adı |
3-Hydroxyphenylacetylene |
Eş anlamlı |
3-Ethynylphenol |
Moleküler Formülü |
C8H6O |
Molekül Ağırlığı |
118.1326 |
InChI |
InChI=1/C8H6O/c1-2-7-4-3-5-8(9)6-7/h1,3-6,9H |
CAS kayıt numarası |
10401-11-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.12g/cm3 |
Kaynama noktası |
230.9°C at 760 mmHg |
Kırılma indisi |
1.589 |
Alevlenme noktası |
106.1°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|