ChemNet > CAS > 104163-35-1 3-Methylthiophene-2-methylamine
104163-35-1 3-Methylthiophene-2-methylamine
Ürün Adı |
3-Methylthiophene-2-methylamine |
Eş anlamlı |
2-Aminomethyl-3-methylthiophene; (3-Methyl-2-thienyl)methylamine; 1-(3-methylthiophen-2-yl)methanamine |
Moleküler Formülü |
C6H9NS |
Molekül Ağırlığı |
127.2074 |
InChI |
InChI=1/C6H9NS/c1-5-2-3-8-6(5)4-7/h2-3H,4,7H2,1H3 |
CAS kayıt numarası |
104163-35-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.104g/cm3 |
Kaynama noktası |
204.6°C at 760 mmHg |
Kırılma indisi |
1.572 |
Alevlenme noktası |
77.5°C |
Tehlike Sembolleri |
C:Corrosive;
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|