ChemNet > CAS > 10570-67-9 4-iodo-2,6-dimethylphenol
10570-67-9 4-iodo-2,6-dimethylphenol
Ürün Adı |
4-iodo-2,6-dimethylphenol |
Eş anlamlı |
2,6-Dimethyl-4-iodophenol; 4-IODO-2,6-XYLENOL; 4-lodo-2,6-dimethyl phenol |
Moleküler Formülü |
C8H9IO |
Molekül Ağırlığı |
248.0609 |
InChI |
InChI=1/C8H9IO/c1-5-3-7(9)4-6(2)8(5)10/h3-4,10H,1-2H3 |
CAS kayıt numarası |
10570-67-9 |
Moleküler Yapısı |
|
Yoğunluk |
1.74g/cm3 |
Ergime noktası |
96℃ |
Kaynama noktası |
278.9°C at 760 mmHg |
Kırılma indisi |
1.629 |
Alevlenme noktası |
122.5°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|