ChemNet > CAS > 1070-62-8 Ethyl hydrogen glutarate
1070-62-8 Ethyl hydrogen glutarate
Ürün Adı |
Ethyl hydrogen glutarate |
Eş anlamlı |
Glutaric acid monoethyl ester~Monoethyl glutarate~Pentanedioic acid monoethyl ester; 5-ethoxy-5-oxopentanoic acid; monoethyl pentanedioate |
Moleküler Formülü |
C7H12O4 |
Molekül Ağırlığı |
160.1678 |
InChI |
InChI=1/C7H12O4/c1-2-11-7(10)5-3-4-6(8)9/h2-5H2,1H3,(H,8,9) |
CAS kayıt numarası |
1070-62-8 |
EINECS |
213-977-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.126g/cm3 |
Kaynama noktası |
280°C at 760 mmHg |
Kırılma indisi |
1.444 |
Alevlenme noktası |
112.5°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|