ChemNet > CAS > 1122-97-0 4-(Methylthio)thiophenol
1122-97-0 4-(Methylthio)thiophenol
Ürün Adı |
4-(Methylthio)thiophenol |
Eş anlamlı |
4-(Methylmercapto)thiophenol~4-(Methylthio)benzenethiol; 4-Mehyl Ithio Thiophenol; 4-(methylsulfanyl)benzenethiol |
Moleküler Formülü |
C7H8S2 |
Molekül Ağırlığı |
156.2684 |
InChI |
InChI=1/C7H8S2/c1-9-7-4-2-6(8)3-5-7/h2-5,8H,1H3 |
CAS kayıt numarası |
1122-97-0 |
Moleküler Yapısı |
|
Yoğunluk |
1.16g/cm3 |
Kaynama noktası |
252.9°C at 760 mmHg |
Kırılma indisi |
1.621 |
Alevlenme noktası |
106.7°C |
Tehlike Sembolleri |
|
Risk Kodları |
R22:Harmful if swallowed.;
R36/38:Irritating to eyes and skin.;
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
|
|