ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
| Ürün Adı |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
| Moleküler Formülü |
C7H11FO2 |
| Molekül Ağırlığı |
146.1594 |
| InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
| CAS kayıt numarası |
1171-47-7 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.159g/cm3 |
| Kaynama noktası |
227.566°C at 760 mmHg |
| Kırılma indisi |
1.454 |
| Alevlenme noktası |
91.429°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|
