ChemNet > CAS > 1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
1171-47-7 2,2-Bis-(4-carboxyphenyl)-hexafluoropropane
Ürün Adı |
2,2-Bis-(4-carboxyphenyl)-hexafluoropropane |
Moleküler Formülü |
C7H11FO2 |
Molekül Ağırlığı |
146.1594 |
InChI |
InChI=1/C7H11FO2/c8-7(6(9)10)4-2-1-3-5-7/h1-5H2,(H,9,10) |
CAS kayıt numarası |
1171-47-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.159g/cm3 |
Kaynama noktası |
227.566°C at 760 mmHg |
Kırılma indisi |
1.454 |
Alevlenme noktası |
91.429°C |
Tehlike Sembolleri |
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36:Wear suitable protective clothing.;
|
|