ChemNet > CAS > 13078-13-2 1-(3-Methylphenyl)piperazine dihydrochloride
13078-13-2 1-(3-Methylphenyl)piperazine dihydrochloride
| Ürün Adı |
1-(3-Methylphenyl)piperazine dihydrochloride |
| Eş anlamlı |
1-(m-Tolyl)piperazine dihydrochloride; 1-(m-Tolyl)piperazine hydrochloride; N-(3-Methylphenyl)piperazine dihydrochloride; 4-(3-methylphenyl)piperazin-1-ium |
| Moleküler Formülü |
C11H17N2 |
| Molekül Ağırlığı |
177.2655 |
| InChI |
InChI=1/C11H16N2/c1-10-3-2-4-11(9-10)13-7-5-12-6-8-13/h2-4,9,12H,5-8H2,1H3/p+1 |
| CAS kayıt numarası |
13078-13-2 |
| EINECS |
235-974-8 |
| Moleküler Yapısı |
|
| Ergime noktası |
195-202℃ |
| Kaynama noktası |
321.4°C at 760 mmHg |
| Alevlenme noktası |
154°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
