ChemNet > CAS > 13194-68-8 4-iodo-2-methylaniline
13194-68-8 4-iodo-2-methylaniline
| Ürün Adı |
4-iodo-2-methylaniline |
| Eş anlamlı |
2-Amino-5-iodotoluene; 4-Iodo-o-toluidine; 4-Iodo-o-toluidine (NH2=1) |
| Moleküler Formülü |
C7H8IN |
| Molekül Ağırlığı |
233.0496 |
| InChI |
InChI=1/C7H8IN/c1-5-4-6(8)2-3-7(5)9/h2-4H,9H2,1H3 |
| CAS kayıt numarası |
13194-68-8 |
| EINECS |
236-154-2 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.791g/cm3 |
| Ergime noktası |
86-89℃ |
| Kaynama noktası |
278.4°C at 760 mmHg |
| Kırılma indisi |
1.663 |
| Alevlenme noktası |
122.1°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
| Güvenlik Açıklaması |
S22:Do not inhale dust.;
S36/37:Wear suitable protective clothing and gloves.;
|
|
