ChemNet > CAS > 133082-13-0 (S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol
133082-13-0 (S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol
| Ürün Adı |
(S)-(+)-1-(2-chlorophenyl)-1,2-ethanediol |
| Eş anlamlı |
(1S)-1-(2-Chlorophenyl)ethane-1,2-diol |
| Moleküler Formülü |
C8H9ClO2 |
| Molekül Ağırlığı |
172.6089 |
| InChI |
InChI=1/C8H9ClO2/c9-7-4-2-1-3-6(7)8(11)5-10/h1-4,8,10-11H,5H2/t8-/m1/s1 |
| CAS kayıt numarası |
133082-13-0 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.328g/cm3 |
| Ergime noktası |
68-75℃ |
| Kaynama noktası |
322°C at 760 mmHg |
| Kırılma indisi |
1.588 |
| Alevlenme noktası |
148.5°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
