ChemNet > CAS > 13322-02-6 4-(bromomethyl)-5-methyl-2-phenyl-2H-1,2,3-triazole
13322-02-6 4-(bromomethyl)-5-methyl-2-phenyl-2H-1,2,3-triazole
| Ürün Adı |
4-(bromomethyl)-5-methyl-2-phenyl-2H-1,2,3-triazole |
| Moleküler Formülü |
C10H10BrN3 |
| Molekül Ağırlığı |
252.1105 |
| InChI |
InChI=1/C10H10BrN3/c1-8-10(7-11)13-14(12-8)9-5-3-2-4-6-9/h2-6H,7H2,1H3 |
| CAS kayıt numarası |
13322-02-6 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.49g/cm3 |
| Ergime noktası |
72℃ |
| Kaynama noktası |
378.4°C at 760 mmHg |
| Kırılma indisi |
1.643 |
| Alevlenme noktası |
182.6°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
