ChemNet > CAS > 135-00-2 2-Benzoylthiophene
135-00-2 2-Benzoylthiophene
Ürün Adı |
2-Benzoylthiophene |
Eş anlamlı |
2-Benzoylthiophene, (Phenyl 2-thienyl ketone); Phenyl 2-thienyl ketone; phenyl(thiophen-2-yl)methanone |
Moleküler Formülü |
C11H8OS |
Molekül Ağırlığı |
188.2456 |
InChI |
InChI=1/C11H8OS/c12-11(10-7-4-8-13-10)9-5-2-1-3-6-9/h1-8H |
CAS kayıt numarası |
135-00-2 |
EINECS |
205-169-6 |
Moleküler Yapısı |
|
Yoğunluk |
1.198g/cm3 |
Kaynama noktası |
300°C at 760 mmHg |
Kırılma indisi |
1.609 |
Alevlenme noktası |
139.7°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S22:Do not inhale dust.;
S24/25:Avoid contact with skin and eyes.;
|
|