ChemNet > CAS > 137577-00-5 2-bromo-1-(5-methyl-1-phenyl-1H-pyrazol-4-yl)-1-ethanone
137577-00-5 2-bromo-1-(5-methyl-1-phenyl-1H-pyrazol-4-yl)-1-ethanone
| Ürün Adı |
2-bromo-1-(5-methyl-1-phenyl-1H-pyrazol-4-yl)-1-ethanone |
| Eş anlamlı |
2-bromo-1-(5-methyl-1-phenyl-1H-pyrazol-4-yl)ethanone |
| Moleküler Formülü |
C12H11BrN2O |
| Molekül Ağırlığı |
279.1325 |
| InChI |
InChI=1/C12H11BrN2O/c1-9-11(12(16)7-13)8-14-15(9)10-5-3-2-4-6-10/h2-6,8H,7H2,1H3 |
| CAS kayıt numarası |
137577-00-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.44g/cm3 |
| Ergime noktası |
93℃ |
| Kaynama noktası |
373.1°C at 760 mmHg |
| Kırılma indisi |
1.621 |
| Alevlenme noktası |
179.5°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
