ChemNet > CAS > 1444-65-1 2-Phenylcyclohexanone
1444-65-1 2-Phenylcyclohexanone
Ürün Adı |
2-Phenylcyclohexanone |
Eş anlamlı |
AI3-07036; Cyclohexanone, 2-phenyl-; (2S)-2-phenylcyclohexanone; (2R)-2-phenylcyclohexanone |
Moleküler Formülü |
C12H14O |
Molekül Ağırlığı |
174.239 |
InChI |
InChI=1/C12H14O/c13-12-9-5-4-8-11(12)10-6-2-1-3-7-10/h1-3,6-7,11H,4-5,8-9H2/t11-/m1/s1 |
CAS kayıt numarası |
1444-65-1 |
EINECS |
215-888-7 |
Moleküler Yapısı |
|
Yoğunluk |
1.042g/cm3 |
Ergime noktası |
56-59℃ |
Kaynama noktası |
294°C at 760 mmHg |
Kırılma indisi |
1.537 |
Alevlenme noktası |
123.7°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|