ChemNet > CAS > 15217-53-5 1-ethyl-1H-1,2,3,4-tetraazole-5-thiol
15217-53-5 1-ethyl-1H-1,2,3,4-tetraazole-5-thiol
| Ürün Adı |
1-ethyl-1H-1,2,3,4-tetraazole-5-thiol |
| Eş anlamlı |
1-Ethyl-5-mercaptotetrazole; 1-ETHYL-5-MERCAPTO-1H-TETRAZOLE; 1-ETHYL-1H-TETRAZOLE-5-THIOL; 1-ethyl-1,2-dihydro-5h-tetrazole-5-thione; 1-ETHYL-1H-1,2,3,4-TETRAZOLE-5-THIOL; 1-Ethyl-5-mercapto-1,2,3,4-tetrazole; 1-ETHYL-1,4-DIHYDRO-TETRAZOLE-5-THIONE |
| Moleküler Formülü |
C3H6N4S |
| Molekül Ağırlığı |
130.1715 |
| InChI |
InChI=1/C3H6N4S/c1-2-7-3(8)4-5-6-7/h2H2,1H3,(H,4,6,8) |
| CAS kayıt numarası |
15217-53-5 |
| EINECS |
239-270-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.53g/cm3 |
| Kaynama noktası |
136.4°C at 760 mmHg |
| Kırılma indisi |
1.737 |
| Alevlenme noktası |
36.3°C |
| Tehlike Sembolleri |
 C:Corrosive;
|
| Risk Kodları |
R34:Causes burns.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|
