ChemNet > CAS > 153863-35-5 (5-methyl-1-phenyl-1H-pyrazol-4-yl)methanol
153863-35-5 (5-methyl-1-phenyl-1H-pyrazol-4-yl)methanol
| Ürün Adı |
(5-methyl-1-phenyl-1H-pyrazol-4-yl)methanol |
| Moleküler Formülü |
C11H12N2O |
| Molekül Ağırlığı |
188.2258 |
| InChI |
InChI=1/C11H12N2O/c1-9-10(8-14)7-12-13(9)11-5-3-2-4-6-11/h2-7,14H,8H2,1H3 |
| CAS kayıt numarası |
153863-35-5 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.14g/cm3 |
| Ergime noktası |
88℃ |
| Kaynama noktası |
346°C at 760 mmHg |
| Kırılma indisi |
1.593 |
| Alevlenme noktası |
163.1°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
