ChemNet > CAS > 1544-86-1 4-(difluoromethoxy)nitrobenzene
1544-86-1 4-(difluoromethoxy)nitrobenzene
Ürün Adı |
4-(difluoromethoxy)nitrobenzene |
Eş anlamlı |
1-(Difluoromethoxy)-4-nitrobenzene; 1-(difluoromethyl)-4-nitrobenzene |
Moleküler Formülü |
C7H5F2NO2 |
Molekül Ağırlığı |
173.1169 |
InChI |
InChI=1/C7H5F2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H |
CAS kayıt numarası |
1544-86-1 |
Moleküler Yapısı |
|
Yoğunluk |
1.339g/cm3 |
Ergime noktası |
33-110℃ |
Kaynama noktası |
240.7°C at 760 mmHg |
Kırılma indisi |
1.5 |
Alevlenme noktası |
111.9°C |
Tehlike Sembolleri |
Xi:Irritant;
|
Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|