ChemNet > CAS > 1544-86-1 4-(difluoromethoxy)nitrobenzene
1544-86-1 4-(difluoromethoxy)nitrobenzene
| Ürün Adı |
4-(difluoromethoxy)nitrobenzene |
| Eş anlamlı |
1-(Difluoromethoxy)-4-nitrobenzene; 1-(difluoromethyl)-4-nitrobenzene |
| Moleküler Formülü |
C7H5F2NO2 |
| Molekül Ağırlığı |
173.1169 |
| InChI |
InChI=1/C7H5F2NO2/c8-7(9)5-1-3-6(4-2-5)10(11)12/h1-4,7H |
| CAS kayıt numarası |
1544-86-1 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.339g/cm3 |
| Ergime noktası |
33-110℃ |
| Kaynama noktası |
240.7°C at 760 mmHg |
| Kırılma indisi |
1.5 |
| Alevlenme noktası |
111.9°C |
| Tehlike Sembolleri |
 Xi:Irritant;
|
| Risk Kodları |
R36/37/38:Irritating to eyes, respiratory system and skin.;
|
| Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S37/39:Wear suitable gloves and eye/face protection.;
|
|
