ChemNet > CAS > 15467-20-6 Nitrilotriacetic acid, disodium salt
15467-20-6 Nitrilotriacetic acid, disodium salt
Ürün Adı |
Nitrilotriacetic acid, disodium salt |
Eş anlamlı |
disodium hydrogen nitrilotriacetate; disodium [(carboxylatomethyl)(carboxymethyl)amino]acetate; 2,2'-[(carboxymethyl)imino]diacetate (non-preferred name); acetate, 2,2',2''-nitrilotris-, sodium salt (1:2) |
Moleküler Formülü |
C6H6NNa2O6 |
Molekül Ağırlığı |
234.095 |
InChI |
InChI=1/C6H9NO6.2Na/c8-4(9)1-7(2-5(10)11)3-6(12)13;;/h1-3H2,(H,8,9)(H,10,11)(H,12,13);;/q;2*+1/p-3 |
CAS kayıt numarası |
15467-20-6 |
EINECS |
239-484-5 |
Moleküler Yapısı |
|
Ergime noktası |
300℃ |
Tehlike Sembolleri |
Xn:Harmful;
|
Risk Kodları |
R22:Harmful if swallowed.;
R40:Possible risks of irreversible effects.;
|
Güvenlik Açıklaması |
S36/37:Wear suitable protective clothing and gloves.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|