ChemNet > CAS > 1638-22-8 p-butylphenol
1638-22-8 p-butylphenol
Ürün Adı |
p-butylphenol |
Eş anlamlı |
4-n-Butylphenol; 4-butylphenol |
Moleküler Formülü |
C10H14O |
Molekül Ağırlığı |
150.2176 |
InChI |
InChI=1/C10H14O/c1-2-3-4-9-5-7-10(11)8-6-9/h5-8,11H,2-4H2,1H3 |
CAS kayıt numarası |
1638-22-8 |
EINECS |
216-672-5 |
Moleküler Yapısı |
|
Yoğunluk |
0.977g/cm3 |
Kaynama noktası |
246.2°C at 760 mmHg |
Kırılma indisi |
1.522 |
Alevlenme noktası |
121.5°C |
Tehlike Sembolleri |
|
Risk Kodları |
R34:Causes burns.;
|
Güvenlik Açıklaması |
S26:In case of contact with eyes, rinse immediately with plenty of water and seek medical advice.;
S36/37/39:Wear suitable protective clothing, gloves and eye/face protection.;
S45:In case of accident of if you feel unwell, seek medical advice immediately (show the label where possible).;
|
|