ChemNet > CAS > 1667-00-1 Cyclopropylphenylmethane
1667-00-1 Cyclopropylphenylmethane
| Ürün Adı |
Cyclopropylphenylmethane |
| Eş anlamlı |
benzylcyclopropane; (cyclopropylmethyl)benzene |
| Moleküler Formülü |
C10H12 |
| Molekül Ağırlığı |
132.2023 |
| InChI |
InChI=1/C10H12/c1-2-4-9(5-3-1)8-10-6-7-10/h1-5,10H,6-8H2 |
| CAS kayıt numarası |
1667-00-1 |
| EINECS |
216-782-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
1.005g/cm3 |
| Kaynama noktası |
189.7°C at 760 mmHg |
| Kırılma indisi |
1.567 |
| Alevlenme noktası |
59.1°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
