ChemNet > CAS > 1667-00-1 Cyclopropylphenylmethane
1667-00-1 Cyclopropylphenylmethane
Ürün Adı |
Cyclopropylphenylmethane |
Eş anlamlı |
benzylcyclopropane; (cyclopropylmethyl)benzene |
Moleküler Formülü |
C10H12 |
Molekül Ağırlığı |
132.2023 |
InChI |
InChI=1/C10H12/c1-2-4-9(5-3-1)8-10-6-7-10/h1-5,10H,6-8H2 |
CAS kayıt numarası |
1667-00-1 |
EINECS |
216-782-3 |
Moleküler Yapısı |
|
Yoğunluk |
1.005g/cm3 |
Kaynama noktası |
189.7°C at 760 mmHg |
Kırılma indisi |
1.567 |
Alevlenme noktası |
59.1°C |
Tehlike Sembolleri |
|
Risk Kodları |
|
Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|