ChemNet > CAS > 1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
1720-32-7 1,6-Diphenyl-1,3,5-hexatriene
| Ürün Adı |
1,6-Diphenyl-1,3,5-hexatriene |
| Eş anlamlı |
DPH; 1,1'-hexa-1,3,5-triene-1,6-diyldibenzene; 1,1'-(1E,3E,5E)-hexa-1,3,5-triene-1,6-diyldibenzene; 1-phenylhexa-1,3,5-trienylbenzene |
| Moleküler Formülü |
C18H16 |
| Molekül Ağırlığı |
232.3196 |
| InChI |
InChI=1/C18H16/c1-2-3-6-15-18(16-11-7-4-8-12-16)17-13-9-5-10-14-17/h2-15H,1H2 |
| CAS kayıt numarası |
1720-32-7 |
| EINECS |
217-011-3 |
| Moleküler Yapısı |
|
| Yoğunluk |
0.988g/cm3 |
| Ergime noktası |
199-203℃ |
| Kaynama noktası |
361°C at 760 mmHg |
| Kırılma indisi |
1.585 |
| Alevlenme noktası |
185.3°C |
| Tehlike Sembolleri |
|
| Risk Kodları |
|
| Güvenlik Açıklaması |
S24/25:Avoid contact with skin and eyes.;
|
|
