ChemNet > CAS > 17249-79-5;17249-29-5 2,3-Dichlorothiophene
17249-79-5;17249-29-5 2,3-Dichlorothiophene
Ürün Adı |
2,3-Dichlorothiophene |
Eş anlamlı |
2,3-dichloro-thiophene |
Moleküler Formülü |
C4H2Cl2S |
Molekül Ağırlığı |
153.0297 |
InChI |
InChI=1/C4H2Cl2S/c5-3-1-2-7-4(3)6/h1-2H |
CAS kayıt numarası |
17249-79-5;17249-29-5 |
Moleküler Yapısı |
|
Yoğunluk |
1.488g/cm3 |
Ergime noktası |
-26℃ |
Kaynama noktası |
170.7°C at 760 mmHg |
Kırılma indisi |
1.584 |
Alevlenme noktası |
68.9°C |
Tehlike Sembolleri |
|
Risk Kodları |
R20/21/22:Harmful by inhalation, in contact with skin and if swallowed.;
|
Güvenlik Açıklaması |
S23:Do not inhale gas/fumes/vapour/spray.;
S36/37:Wear suitable protective clothing and gloves.;
|
|